CAS 2580103-26-8 appears in our catalog under these names: (R)-1-(4,4-Difluorocyclohexyl)ethan-1-amine hydrochloride, 95%, (1R)-1-(4,4-DIFLUOROCYCLOHEXYL)ETHAN-1-AMINE HYDROCHLORIDE, 98%, 98%, (R)-1-(4,4-Difluorocyclohexyl)ethanamine hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(1R)-1-(4,4-difluorocyclohexyl)ethanamine;hydrochloride (CAS 2580103-26-8) is a chemical compound with the molecular formula C8H16ClF2N and a molecular weight of 199.67 g/mol. IUPAC name: (1R)-1-(4,4-difluorocyclohexyl)ethanamine;hydrochloride. InChIKey: ZVAYNUUVMZVORD-FYZOBXCZSA-N.
| Molecular formula | C8H16ClF2N |
|---|---|
| Molecular weight | 199.67 g/mol |
| IUPAC name | (1R)-1-(4,4-difluorocyclohexyl)ethanamine;hydrochloride |
| InChIKey | ZVAYNUUVMZVORD-FYZOBXCZSA-N |
| SMILES | C[C@H](C1CCC(CC1)(F)F)N.Cl |
Computed by PubChem (NCBI)