CAS 2445792-69-6 is the registry number for Methyl 4-(2,4-difluorophenyl)isoxazole-3-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Methyl 4-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylate (CAS 2445792-69-6) is a chemical compound with the molecular formula C11H7F2NO3 and a molecular weight of 239.17 g/mol. IUPAC name: methyl 4-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylate. InChIKey: FYEVJJMSGWWKKS-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO3 |
|---|---|
| Molecular weight | 239.17 g/mol |
| IUPAC name | methyl 4-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | FYEVJJMSGWWKKS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NOC=C1C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)