CAS 24477-36-9 appears in our catalog under these names: 5-Methyl-N-(4-sulfamoylphenethyl)isoxazole-3-carboxamide, 98%, 5-Methyl-N-(2-(4-sulfamoylphenyl)ethyl)-1,2-oxazole-3-carboxamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 25mg.
5-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-3-carboxamide (CAS 24477-36-9) is a chemical compound with the molecular formula C13H15N3O4S and a molecular weight of 309.34 g/mol. IUPAC name: 5-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-3-carboxamide. InChIKey: KFGWNIGZMCIXJX-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4S |
|---|---|
| Molecular weight | 309.34 g/mol |
| IUPAC name | 5-methyl-N-[2-(4-sulfamoylphenyl)ethyl]-1,2-oxazole-3-carboxamide |
| InChIKey | KFGWNIGZMCIXJX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NO1)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)