CAS 36326-07-5 is the registry number for N-(4-(N-(4,5-Dimethyloxazol-2-yl)sulfamoyl)phenyl)acetamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfamoyl]phenyl]acetamide (CAS 36326-07-5) is a chemical compound with the molecular formula C13H15N3O4S and a molecular weight of 309.34 g/mol. IUPAC name: N-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfamoyl]phenyl]acetamide. InChIKey: BCGBRLMXWWNZLS-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O4S |
|---|---|
| Molecular weight | 309.34 g/mol |
| IUPAC name | N-[4-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfamoyl]phenyl]acetamide |
| InChIKey | BCGBRLMXWWNZLS-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=N1)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C)C |
Computed by PubChem (NCBI)