Products 2448475-34-9
CAS 2448475-34-9 is the registry number for Triethylammonium 5-nitrobenzofuran-2-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
N,N-diethylethanamine;5-nitro-1-benzofuran-2-carboxylic acid (CAS 2448475-34-9) is a chemical compound with the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. IUPAC name: N,N-diethylethanamine;5-nitro-1-benzofuran-2-carboxylic acid. InChIKey: MLTZRLOBUJHDNT-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O5 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | N,N-diethylethanamine;5-nitro-1-benzofuran-2-carboxylic acid |
| InChIKey | MLTZRLOBUJHDNT-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.C1=CC2=C(C=C1[N+](=O)[O-])C=C(O2)C(=O)O |
Computed by PubChem (NCBI)