Products 2448475-87-2
CAS 2448475-87-2 is the registry number for 4,4''-Diamino-[1,1':4',1''-terphenyl]-2,2''-dicarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-amino-2-[4-(4-amino-2-carboxyphenyl)phenyl]benzoic acid (CAS 2448475-87-2) is a chemical compound with the molecular formula C20H16N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: 5-amino-2-[4-(4-amino-2-carboxyphenyl)phenyl]benzoic acid. InChIKey: GOZMLVXDJOPRTA-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 5-amino-2-[4-(4-amino-2-carboxyphenyl)phenyl]benzoic acid |
| InChIKey | GOZMLVXDJOPRTA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)N)C(=O)O)C3=C(C=C(C=C3)N)C(=O)O |
Computed by PubChem (NCBI)