Products 2452302-73-5
CAS 2452302-73-5 is the registry number for Anti-MRSA agent 6. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,5-difluoro-N-[(E)-quinolin-3-ylmethylideneamino]aniline (CAS 2452302-73-5) is a chemical compound with the molecular formula C16H11F2N3 and a molecular weight of 283.27 g/mol. IUPAC name: 2,5-difluoro-N-[(E)-quinolin-3-ylmethylideneamino]aniline. InChIKey: PPFKQUSDPLHQGP-KEBDBYFISA-N.
| Molecular formula | C16H11F2N3 |
|---|---|
| Molecular weight | 283.27 g/mol |
| IUPAC name | 2,5-difluoro-N-[(E)-quinolin-3-ylmethylideneamino]aniline |
| InChIKey | PPFKQUSDPLHQGP-KEBDBYFISA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)/C=N/NC3=C(C=CC(=C3)F)F |
Computed by PubChem (NCBI)
Synonyms:
Anti-MRSA agent 6