CAS 2452398-44-4 is the registry number for Rel-benzyl ((2R,3S)-4,4-dimethyl-5-oxo-2-phenylpyrrolidin-3-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl N-[(2S,3R)-4,4-dimethyl-5-oxo-2-phenylpyrrolidin-3-yl]carbamate (CAS 2452398-44-4) is a chemical compound with the molecular formula C20H22N2O3 and a molecular weight of 338.4 g/mol. IUPAC name: benzyl N-[(2S,3R)-4,4-dimethyl-5-oxo-2-phenylpyrrolidin-3-yl]carbamate. InChIKey: OEKJIEBCGQZZRP-IRXDYDNUSA-N.
| Molecular formula | C20H22N2O3 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | benzyl N-[(2S,3R)-4,4-dimethyl-5-oxo-2-phenylpyrrolidin-3-yl]carbamate |
| InChIKey | OEKJIEBCGQZZRP-IRXDYDNUSA-N |
| SMILES | CC1([C@H]([C@@H](NC1=O)C2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3)C |
Computed by PubChem (NCBI)