Products 753922-08-6

CAS 753922-08-6 is the registry number for 6-Benzyloxy-3-methyl-indazole-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-methyl-6-phenylmethoxyindazole-1-carboxylate (CAS 753922-08-6) is a chemical compound with the molecular formula C20H22N2O3 and a molecular weight of 338.4 g/mol. IUPAC name: tert-butyl 3-methyl-6-phenylmethoxyindazole-1-carboxylate. InChIKey: OHUGEITWYFXHTH-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22N2O3
Molecular weight338.4 g/mol
IUPAC nametert-butyl 3-methyl-6-phenylmethoxyindazole-1-carboxylate
InChIKeyOHUGEITWYFXHTH-UHFFFAOYSA-N
SMILESCC1=NN(C2=C1C=CC(=C2)OCC3=CC=CC=C3)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)