Products 2453296-56-3
CAS 2453296-56-3 is the registry number for (2S,4R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-4-fluoropiperidine-2-carboxylic acid, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropiperidine-2-carboxylic acid (CAS 2453296-56-3) is a chemical compound with the molecular formula C21H20FNO4 and a molecular weight of 369.4 g/mol. IUPAC name: (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropiperidine-2-carboxylic acid. InChIKey: WEMCBTILEUOXQA-YJYMSZOUSA-N.
| Molecular formula | C21H20FNO4 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2S,4R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-fluoropiperidine-2-carboxylic acid |
| InChIKey | WEMCBTILEUOXQA-YJYMSZOUSA-N |
| SMILES | C1CN([C@@H](C[C@@H]1F)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)