CAS 2453296-92-7 appears in our catalog under these names: (S)-7-Fluoro-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%, 97%, (S)-7-Fluoro-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(3S)-7-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2453296-92-7) is a chemical compound with the molecular formula C8H9ClFNO and a molecular weight of 189.61 g/mol. IUPAC name: (3S)-7-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: PQIJNAJAAMHSNW-OGFXRTJISA-N.
| Molecular formula | C8H9ClFNO |
|---|---|
| Molecular weight | 189.61 g/mol |
| IUPAC name | (3S)-7-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | PQIJNAJAAMHSNW-OGFXRTJISA-N |
| SMILES | C1[C@H](C2=C(O1)C(=CC=C2)F)N.Cl |
Computed by PubChem (NCBI)