CAS 2470436-13-4 appears in our catalog under these names: 7-Fluoro-2,3-dihydrobenzofuran-3-amine hcl, 97%, 97%, 7-FLUORO-2,3-DIHYDROBENZOFURAN-3-AMINE HCL, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
7-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2470436-13-4) is a chemical compound with the molecular formula C8H9ClFNO and a molecular weight of 189.61 g/mol. IUPAC name: 7-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: PQIJNAJAAMHSNW-UHFFFAOYSA-N.
| Molecular formula | C8H9ClFNO |
|---|---|
| Molecular weight | 189.61 g/mol |
| IUPAC name | 7-fluoro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | PQIJNAJAAMHSNW-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=CC=C2)F)N.Cl |
Computed by PubChem (NCBI)