Products 2454133-88-9
CAS 2454133-88-9 is the registry number for Antitumor agent-70. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(E)-[4-[(4-methylphenyl)carbamoyl]phenyl]methylideneamino]pyridine-3-carboxamide (CAS 2454133-88-9) is a chemical compound with the molecular formula C21H18N4O2 and a molecular weight of 358.4 g/mol. IUPAC name: N-[(E)-[4-[(4-methylphenyl)carbamoyl]phenyl]methylideneamino]pyridine-3-carboxamide. InChIKey: IXYMMBYRNJWPSX-YDZHTSKRSA-N.
| Molecular formula | C21H18N4O2 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | N-[(E)-[4-[(4-methylphenyl)carbamoyl]phenyl]methylideneamino]pyridine-3-carboxamide |
| InChIKey | IXYMMBYRNJWPSX-YDZHTSKRSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)C2=CC=C(C=C2)/C=N/NC(=O)C3=CN=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Antitumor agent-70, orb1688724