CAS 2454396-63-3 is the registry number for 2,4,7,8-Tetrachloropyrido(4,3-d)pyrimidine, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2,4,7,8-tetrachloropyrido[4,3-d]pyrimidine (CAS 2454396-63-3) is a chemical compound with the molecular formula C7HCl4N3 and a molecular weight of 268.9 g/mol. IUPAC name: 2,4,7,8-tetrachloropyrido[4,3-d]pyrimidine. InChIKey: LGUZLYPYPXLWRI-UHFFFAOYSA-N.
| Molecular formula | C7HCl4N3 |
|---|---|
| Molecular weight | 268.9 g/mol |
| IUPAC name | 2,4,7,8-tetrachloropyrido[4,3-d]pyrimidine |
| InChIKey | LGUZLYPYPXLWRI-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=N1)Cl)Cl)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)