CAS 2867534-64-1 is the registry number for 2,4,6,7-Tetrachloropyrido[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6,7-tetrachloropyrido[2,3-d]pyrimidine (CAS 2867534-64-1) is a chemical compound with the molecular formula C7HCl4N3 and a molecular weight of 268.9 g/mol. IUPAC name: 2,4,6,7-tetrachloropyrido[2,3-d]pyrimidine. InChIKey: WWLVSBBXUKRZQT-UHFFFAOYSA-N.
| Molecular formula | C7HCl4N3 |
|---|---|
| Molecular weight | 268.9 g/mol |
| IUPAC name | 2,4,6,7-tetrachloropyrido[2,3-d]pyrimidine |
| InChIKey | WWLVSBBXUKRZQT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=C1Cl)Cl)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)