Products 2454492-43-2
CAS 2454492-43-2 is the registry number for UB 165 fumarate/ 98.91% (existing batch purity). Offered by: TargetMol. Available pack sizes: 1mg, 25mg, 50mg, 100mg.
(E)-but-2-enedioic acid;(1R,6R)-2-(6-chloro-3-pyridinyl)-9-azabicyclo[4.2.1]non-2-ene (CAS 2454492-43-2) is a chemical compound with the molecular formula C17H19ClN2O4 and a molecular weight of 350.8 g/mol. IUPAC name: (E)-but-2-enedioic acid;(1R,6R)-2-(6-chloro-3-pyridinyl)-9-azabicyclo[4.2.1]non-2-ene. InChIKey: DZFRKSLRKAKJIB-KCNVDIGLSA-N.
| Molecular formula | C17H19ClN2O4 |
|---|---|
| Molecular weight | 350.8 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;(1R,6R)-2-(6-chloro-3-pyridinyl)-9-azabicyclo[4.2.1]non-2-ene |
| InChIKey | DZFRKSLRKAKJIB-KCNVDIGLSA-N |
| SMILES | C1C[C@@H]2CC[C@@H](N2)C(=C1)C3=CN=C(C=C3)Cl.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)