CAS 245487-62-1 is the registry number for 4-Methyl-1-(L-alanyl)-piperazine dihydrochloride. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
(2S)-2-amino-1-(4-methylpiperazin-1-yl)propan-1-one;dihydrochloride (CAS 245487-62-1) is a chemical compound with the molecular formula C8H19Cl2N3O and a molecular weight of 244.16 g/mol. IUPAC name: (2S)-2-amino-1-(4-methylpiperazin-1-yl)propan-1-one;dihydrochloride. InChIKey: WQWJCMWMJVOJAS-KLXURFKVSA-N.
| Molecular formula | C8H19Cl2N3O |
|---|---|
| Molecular weight | 244.16 g/mol |
| IUPAC name | (2S)-2-amino-1-(4-methylpiperazin-1-yl)propan-1-one;dihydrochloride |
| InChIKey | WQWJCMWMJVOJAS-KLXURFKVSA-N |
| SMILES | C[C@@H](C(=O)N1CCN(CC1)C)N.Cl.Cl |
Computed by PubChem (NCBI)