Products 24558-84-7
CAS 24558-84-7 is the registry number for 4-Amino-4-deoxy-D-glucopyranose. Offered by: Biosynth. Available pack sizes: 10mg, 50mg, 25mg.
(2R,3S,4R,5S)-4-amino-2,3,5,6-tetrahydroxyhexanal (CAS 24558-84-7) is a chemical compound with the molecular formula C6H13NO5 and a molecular weight of 179.17 g/mol. IUPAC name: (2R,3S,4R,5S)-4-amino-2,3,5,6-tetrahydroxyhexanal. InChIKey: RQRVMSIARGXSFL-JGWLITMVSA-N.
| Molecular formula | C6H13NO5 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | (2R,3S,4R,5S)-4-amino-2,3,5,6-tetrahydroxyhexanal |
| InChIKey | RQRVMSIARGXSFL-JGWLITMVSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C=O)O)O)N)O)O |
Computed by PubChem (NCBI)