Products 2456339-94-7
CAS 2456339-94-7 appears in our catalog under these names: Apixaban Impurity 119, Apixaban Impurity 65. Offered by: Chemat Brand. Available pack sizes: on request.
3-morpholin-4-yl-1-(4-nitrophenyl)piperidin-2-one (CAS 2456339-94-7) is a chemical compound with the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. IUPAC name: 3-morpholin-4-yl-1-(4-nitrophenyl)piperidin-2-one. InChIKey: RTIMRRALUPJKGO-UHFFFAOYSA-N.
| Molecular formula | C15H19N3O4 |
|---|---|
| Molecular weight | 305.33 g/mol |
| IUPAC name | 3-morpholin-4-yl-1-(4-nitrophenyl)piperidin-2-one |
| InChIKey | RTIMRRALUPJKGO-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)C2=CC=C(C=C2)[N+](=O)[O-])N3CCOCC3 |
Computed by PubChem (NCBI)