CAS 245652-64-6 appears in our catalog under these names: 5-(Phenylthio)benzene-1,3-diamine, 95%, 5-(Phenylthio)benzene-1,3-diamine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-phenylsulfanylbenzene-1,3-diamine (CAS 245652-64-6) is a chemical compound with the molecular formula C12H12N2S and a molecular weight of 216.30 g/mol. IUPAC name: 5-phenylsulfanylbenzene-1,3-diamine. InChIKey: HNTINUIMKOOHJJ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2S |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | 5-phenylsulfanylbenzene-1,3-diamine |
| InChIKey | HNTINUIMKOOHJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)SC2=CC(=CC(=C2)N)N |
Computed by PubChem (NCBI)