CAS 5873-51-8 appears in our catalog under these names: 2,2'-Diaminodiphenyl sulfide, 98%, 2,2-Thiodianiline, 98%, 2,2′–Diaminophenylsulfide, Bis(2-aminophenyl) Sulfide, >98.0%(HPLC)(T), 2,2'-Thiodianiline, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 5g, 100g, 1g.
2-(2-aminophenyl)sulfanylaniline (CAS 5873-51-8) is a chemical compound with the molecular formula C12H12N2S and a molecular weight of 216.30 g/mol. IUPAC name: 2-(2-aminophenyl)sulfanylaniline. InChIKey: WRRQKFXVKRQPDB-UHFFFAOYSA-N.
| Molecular formula | C12H12N2S |
|---|---|
| Molecular weight | 216.30 g/mol |
| IUPAC name | 2-(2-aminophenyl)sulfanylaniline |
| InChIKey | WRRQKFXVKRQPDB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)SC2=CC=CC=C2N |
Computed by PubChem (NCBI)