Products 245744-18-7
CAS 245744-18-7 appears in our catalog under these names: TC–G 1000, TC-G 1000. Offered by: GLPBio, Biosynth. Available pack sizes: 10mg, 50mg, 25mg, 100mg.
(Z)-but-2-enedioic acid;5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole (CAS 245744-18-7) is a chemical compound with the molecular formula C17H18N2O4S and a molecular weight of 346.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole. InChIKey: OPCJPAYHMCWCGW-BTJKTKAUSA-N.
| Molecular formula | C17H18N2O4S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;5-(1,3-dimethyl-6,7-dihydro-2-benzothiophen-4-yl)-1H-imidazole |
| InChIKey | OPCJPAYHMCWCGW-BTJKTKAUSA-N |
| SMILES | CC1=C2CCC=C(C2=C(S1)C)C3=CN=CN3.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)