CAS 329932-88-9 is the registry number for 3-((4-Phenylpiperazin-1-yl)sulfonyl)benzoic acid, 98%. Offered by: AmBeed. Available pack sizes: 5g.
3-(4-phenylpiperazin-1-yl)sulfonylbenzoic acid (CAS 329932-88-9) is a chemical compound with the molecular formula C17H18N2O4S and a molecular weight of 346.4 g/mol. IUPAC name: 3-(4-phenylpiperazin-1-yl)sulfonylbenzoic acid. InChIKey: XPDAYARHVAIRCS-UHFFFAOYSA-N.
| Molecular formula | C17H18N2O4S |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | 3-(4-phenylpiperazin-1-yl)sulfonylbenzoic acid |
| InChIKey | XPDAYARHVAIRCS-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=C2)S(=O)(=O)C3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)