Products 245759-66-4
CAS 245759-66-4 appears in our catalog under these names: Formoterol Impurity 27, Formoterol Impurity 38. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-4-[(1S)-1-hydroxy-2-[[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenol (CAS 245759-66-4) is a chemical compound with the molecular formula C18H24N2O3 and a molecular weight of 316.4 g/mol. IUPAC name: 2-amino-4-[(1S)-1-hydroxy-2-[[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenol. InChIKey: AMISPUNGCBUARA-KPZWWZAWSA-N.
| Molecular formula | C18H24N2O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 2-amino-4-[(1S)-1-hydroxy-2-[[(2S)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenol |
| InChIKey | AMISPUNGCBUARA-KPZWWZAWSA-N |
| SMILES | C[C@@H](CC1=CC=C(C=C1)OC)NC[C@H](C2=CC(=C(C=C2)O)N)O |
Computed by PubChem (NCBI)