Products 245759-62-0
CAS 245759-62-0 appears in our catalog under these names: ArforMoterol Tartrate Impurity 1, Formoterol Impurity 7, Formoterol Impurity 18, (alphaR)-3-Amino-4-hydroxy-alpha-((((1R)-2-(4-methoxyphenyl)-1-methylethyl)amino)methyl)benzenemethanol. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-amino-4-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenol (CAS 245759-62-0) is a chemical compound with the molecular formula C18H24N2O3 and a molecular weight of 316.4 g/mol. IUPAC name: 2-amino-4-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenol. InChIKey: AMISPUNGCBUARA-XIKOKIGWSA-N.
| Molecular formula | C18H24N2O3 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 2-amino-4-[(1R)-1-hydroxy-2-[[(2R)-1-(4-methoxyphenyl)propan-2-yl]amino]ethyl]phenol |
| InChIKey | AMISPUNGCBUARA-XIKOKIGWSA-N |
| SMILES | C[C@H](CC1=CC=C(C=C1)OC)NC[C@@H](C2=CC(=C(C=C2)O)N)O |
Computed by PubChem (NCBI)