CAS 2459635-19-7 is the registry number for 1,1-Dimethylethyl N-(5-bromopyrazolo[1,5-a]pyridin-2-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-(5-bromopyrazolo[1,5-a]pyridin-2-yl)carbamate (CAS 2459635-19-7) is a chemical compound with the molecular formula C12H14BrN3O2 and a molecular weight of 312.16 g/mol. IUPAC name: tert-butyl N-(5-bromopyrazolo[1,5-a]pyridin-2-yl)carbamate. InChIKey: FNDYTUUKQMCZLU-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN3O2 |
|---|---|
| Molecular weight | 312.16 g/mol |
| IUPAC name | tert-butyl N-(5-bromopyrazolo[1,5-a]pyridin-2-yl)carbamate |
| InChIKey | FNDYTUUKQMCZLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NN2C=CC(=CC2=C1)Br |
Computed by PubChem (NCBI)