CAS 2460708-45-4 is the registry number for Methyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-7-carboxylate (CAS 2460708-45-4) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: methyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-7-carboxylate. InChIKey: ABSLLZIIUHRAAR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | methyl 4-bromo-1H-pyrrolo[2,3-c]pyridine-7-carboxylate |
| InChIKey | ABSLLZIIUHRAAR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C2=C1NC=C2)Br |
Computed by PubChem (NCBI)