CAS 24629-78-5 is the registry number for (1R,2R,4R)-1,7,7-Trimethylbicyclo(2.2.1)heptan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine;hydrochloride (CAS 24629-78-5) is a chemical compound with the molecular formula C10H20ClN and a molecular weight of 189.72 g/mol. IUPAC name: (1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine;hydrochloride. InChIKey: XVVITZVHMWAHIG-NDYRHZEOSA-N.
| Molecular formula | C10H20ClN |
|---|---|
| Molecular weight | 189.72 g/mol |
| IUPAC name | (1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-amine;hydrochloride |
| InChIKey | XVVITZVHMWAHIG-NDYRHZEOSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)C[C@H]2N.Cl |
Computed by PubChem (NCBI)