CAS 24638-25-3 appears in our catalog under these names: 3H-Imidazo[4,5-b]pyridin-6-amine dihydrochloride 98%, 3H-imidazo[4,5-b]pyridin-6-amine dihydrochloride, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g.
1H-imidazo[4,5-b]pyridin-6-amine;dihydrochloride (CAS 24638-25-3) is a chemical compound with the molecular formula C6H8Cl2N4 and a molecular weight of 207.06 g/mol. IUPAC name: 1H-imidazo[4,5-b]pyridin-6-amine;dihydrochloride. InChIKey: KZSJKFGIMWWYFP-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2N4 |
|---|---|
| Molecular weight | 207.06 g/mol |
| IUPAC name | 1H-imidazo[4,5-b]pyridin-6-amine;dihydrochloride |
| InChIKey | KZSJKFGIMWWYFP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1NC=N2)N.Cl.Cl |
Computed by PubChem (NCBI)