CAS 3703-10-4 is the registry number for 2,4-Dichloro-6-isopropylamino-1,3,5-triazine. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
4,6-dichloro-N-propan-2-yl-1,3,5-triazin-2-amine (CAS 3703-10-4) is a chemical compound with the molecular formula C6H8Cl2N4 and a molecular weight of 207.06 g/mol. IUPAC name: 4,6-dichloro-N-propan-2-yl-1,3,5-triazin-2-amine. InChIKey: JDAPQMINSZDTBM-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2N4 |
|---|---|
| Molecular weight | 207.06 g/mol |
| IUPAC name | 4,6-dichloro-N-propan-2-yl-1,3,5-triazin-2-amine |
| InChIKey | JDAPQMINSZDTBM-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=NC(=NC(=N1)Cl)Cl |
Computed by PubChem (NCBI)