CAS 24638-58-2 appears in our catalog under these names: 6-Cyclopentyl-1,3,5-triazine-2,4-diamine, 95%, 6-Cyclopentyl-1,3,5-triazine-2,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-cyclopentyl-1,3,5-triazine-2,4-diamine (CAS 24638-58-2) is a chemical compound with the molecular formula C8H13N5 and a molecular weight of 179.22 g/mol. IUPAC name: 6-cyclopentyl-1,3,5-triazine-2,4-diamine. InChIKey: JDVPCYNJSHTFEZ-UHFFFAOYSA-N.
| Molecular formula | C8H13N5 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 6-cyclopentyl-1,3,5-triazine-2,4-diamine |
| InChIKey | JDVPCYNJSHTFEZ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NC(=NC(=N2)N)N |
Computed by PubChem (NCBI)