CAS 634165-96-1 is the registry number for 6-Cyclopropyl-n,n-dimethyl-1,3,5-triazine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-cyclopropyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (CAS 634165-96-1) is a chemical compound with the molecular formula C8H13N5 and a molecular weight of 179.22 g/mol. IUPAC name: 6-cyclopropyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine. InChIKey: SFPXQYOZUGOKSD-UHFFFAOYSA-N.
| Molecular formula | C8H13N5 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 6-cyclopropyl-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| InChIKey | SFPXQYOZUGOKSD-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NC(=N1)N)C2CC2 |
Computed by PubChem (NCBI)