CAS 24658-26-2 is the registry number for 1,4-Dimethoxybenzene-D6. Offered by: TRC. Available pack sizes: 100mg.
1,4-bis(trideuteriomethoxy)benzene (CAS 24658-26-2) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 144.20 g/mol. IUPAC name: 1,4-bis(trideuteriomethoxy)benzene. InChIKey: OHBQPCCCRFSCAX-WFGJKAKNSA-N.
| Molecular formula | C8H10O2 |
|---|---|
| Molecular weight | 144.20 g/mol |
| IUPAC name | 1,4-bis(trideuteriomethoxy)benzene |
| InChIKey | OHBQPCCCRFSCAX-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=C(C=C1)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)