Products 74079-00-8
CAS 74079-00-8 appears in our catalog under these names: 1,4-Dimethoxybenzene-d10, 98 atom % D, min 98% Chemical Purity, 1,4-Dimethoxybenzene-d10, 99.6%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 25 mg, 10 mg, 100 mg, 50 mg.
1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethoxy)benzene (CAS 74079-00-8) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 148.22 g/mol. IUPAC name: 1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethoxy)benzene. InChIKey: OHBQPCCCRFSCAX-ZGYYUIRESA-N.
| Molecular formula | C8H10O2 |
|---|---|
| Molecular weight | 148.22 g/mol |
| IUPAC name | 1,2,4,5-tetradeuterio-3,6-bis(trideuteriomethoxy)benzene |
| InChIKey | OHBQPCCCRFSCAX-ZGYYUIRESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OC([2H])([2H])[2H])[2H])[2H])OC([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)