Products 24667-06-9

CAS 24667-06-9 is the registry number for 1-Ethyl-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-ethyl-4,6-dimethyl-2-oxopyridine-3-carboxylic acid (CAS 24667-06-9) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 1-ethyl-4,6-dimethyl-2-oxopyridine-3-carboxylic acid. InChIKey: IBBHEXXKVUJJEO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO3
Molecular weight195.21 g/mol
IUPAC name1-ethyl-4,6-dimethyl-2-oxopyridine-3-carboxylic acid
InChIKeyIBBHEXXKVUJJEO-UHFFFAOYSA-N
SMILESCCN1C(=CC(=C(C1=O)C(=O)O)C)C

Computed by PubChem (NCBI)