CAS 24667-06-9 is the registry number for 1-Ethyl-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-ethyl-4,6-dimethyl-2-oxopyridine-3-carboxylic acid (CAS 24667-06-9) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 1-ethyl-4,6-dimethyl-2-oxopyridine-3-carboxylic acid. InChIKey: IBBHEXXKVUJJEO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 1-ethyl-4,6-dimethyl-2-oxopyridine-3-carboxylic acid |
| InChIKey | IBBHEXXKVUJJEO-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC(=C(C1=O)C(=O)O)C)C |
Computed by PubChem (NCBI)