Products 2468028-33-1
CAS 2468028-33-1 is the registry number for 5-chloro-2-(difluoromethyl)pyrazolo[4,3-b]pyridine. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-chloro-2-(difluoromethyl)pyrazolo[4,3-b]pyridine (CAS 2468028-33-1) is a chemical compound with the molecular formula C7H4ClF2N3 and a molecular weight of 203.57 g/mol. IUPAC name: 5-chloro-2-(difluoromethyl)pyrazolo[4,3-b]pyridine. InChIKey: YBRCZHNALIVVGK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2N3 |
|---|---|
| Molecular weight | 203.57 g/mol |
| IUPAC name | 5-chloro-2-(difluoromethyl)pyrazolo[4,3-b]pyridine |
| InChIKey | YBRCZHNALIVVGK-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=CN(N=C21)C(F)F)Cl |
Computed by PubChem (NCBI)