Products 2919213-78-6
CAS 2919213-78-6 is the registry number for 2-Chloro-6-(difluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-6-(difluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine (CAS 2919213-78-6) is a chemical compound with the molecular formula C7H4ClF2N3 and a molecular weight of 203.57 g/mol. IUPAC name: 2-chloro-6-(difluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: UMYLBDIZZHXDEY-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF2N3 |
|---|---|
| Molecular weight | 203.57 g/mol |
| IUPAC name | 2-chloro-6-(difluoromethyl)-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | UMYLBDIZZHXDEY-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=NC(=NC=C21)Cl)C(F)F |
Computed by PubChem (NCBI)