CAS 246870-45-1 is the registry number for Rel-methyl (2S,3S)-3-phenylpyrrolidine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S,3S)-3-phenylpyrrolidine-2-carboxylate (CAS 246870-45-1) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: methyl (2S,3S)-3-phenylpyrrolidine-2-carboxylate. InChIKey: RSBPLPJKAAQLFC-QWRGUYRKSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | methyl (2S,3S)-3-phenylpyrrolidine-2-carboxylate |
| InChIKey | RSBPLPJKAAQLFC-QWRGUYRKSA-N |
| SMILES | COC(=O)[C@@H]1[C@@H](CCN1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)