Products 1274904-54-9

CAS 1274904-54-9 is the registry number for Trans-3-[(phenylmethyl)amino]cyclobutanecarboxylic acid tfa (1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(benzylamino)cyclobutane-1-carboxylic acid (CAS 1274904-54-9) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 3-(benzylamino)cyclobutane-1-carboxylic acid. InChIKey: AEZROTIRNKHKAU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO2
Molecular weight205.25 g/mol
IUPAC name3-(benzylamino)cyclobutane-1-carboxylic acid
InChIKeyAEZROTIRNKHKAU-UHFFFAOYSA-N
SMILESC1C(CC1NCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)