Products 24691-16-5
CAS 24691-16-5 appears in our catalog under these names: Acetic acid cis-3,3,5-trimethylcyclohexyl ester, 97%, cis-3,3,5-Trimethylcyclohexyl acetate, 95+%, cis-3,3,5-Trimethylcyclohexyl Acetate, >97.0%(GC). Offered by: Combi-blocks, Chemat Brand, TCI. Available pack sizes: 5g, 100g, 25g, 1g, on request, 25ml.
[(1R,5R)-3,3,5-trimethylcyclohexyl] acetate (CAS 24691-16-5) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: [(1R,5R)-3,3,5-trimethylcyclohexyl] acetate. InChIKey: OIVWFAFCHQDCCG-WCBMZHEXSA-N.
| Molecular formula | C11H20O2 |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | [(1R,5R)-3,3,5-trimethylcyclohexyl] acetate |
| InChIKey | OIVWFAFCHQDCCG-WCBMZHEXSA-N |
| SMILES | C[C@H]1C[C@H](CC(C1)(C)C)OC(=O)C |
Computed by PubChem (NCBI)