CAS 16052-40-7 appears in our catalog under these names: (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanecarboxylic acid, 95%, (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanecarboxylic Acid, (1R,2S,5R)-2-Isopropyl-5-methyl-cyclohexanecarboxylic acid, (1R,2S,5R)-2-Isopropyl-5-methylcyclohexanecarboxylic acid 97%, (1R,2S,5R)-2-Isopropyl-5-Methylcyclohexanecarboxylic Acid, 97%, 97%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 500mg, 250mg, 100g, 500g.
(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid (CAS 16052-40-7) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid. InChIKey: MNVSUVYRIVXDBK-KXUCPTDWSA-N.
| Molecular formula | C11H20O2 |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | (1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexane-1-carboxylic acid |
| InChIKey | MNVSUVYRIVXDBK-KXUCPTDWSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)C(=O)O)C(C)C |
Computed by PubChem (NCBI)