Products 2469274-09-5
CAS 2469274-09-5 is the registry number for Octisalate-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-ethylhexyl 2,3,4,5-tetradeuterio-6-hydroxybenzoate (CAS 2469274-09-5) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 254.36 g/mol. IUPAC name: 2-ethylhexyl 2,3,4,5-tetradeuterio-6-hydroxybenzoate. InChIKey: FMRHJJZUHUTGKE-NECLWFIRSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 254.36 g/mol |
| IUPAC name | 2-ethylhexyl 2,3,4,5-tetradeuterio-6-hydroxybenzoate |
| InChIKey | FMRHJJZUHUTGKE-NECLWFIRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)OCC(CC)CCCC)O)[2H])[2H] |
Computed by PubChem (NCBI)