CAS 2469279-29-4 appears in our catalog under these names: Ciprofibrate EP Impurity C, 2-(4-(2,2-Dichlorocyclopropyl)phenoxy)-2-methylpropan-1-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg.
2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropan-1-ol (CAS 2469279-29-4) is a chemical compound with the molecular formula C13H16Cl2O2 and a molecular weight of 275.17 g/mol. IUPAC name: 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropan-1-ol. InChIKey: DFTUCOMNHKOWDM-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2O2 |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropan-1-ol |
| InChIKey | DFTUCOMNHKOWDM-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)OC1=CC=C(C=C1)C2CC2(Cl)Cl |
Computed by PubChem (NCBI)