CAS 83833-32-3 is the registry number for 2-(2,4-Dichlorophenyl)-2-methyl-4-propyl-1,3-dioxolane. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dichlorophenyl)-2-methyl-4-propyl-1,3-dioxolane (CAS 83833-32-3) is a chemical compound with the molecular formula C13H16Cl2O2 and a molecular weight of 275.17 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-2-methyl-4-propyl-1,3-dioxolane. InChIKey: ZOVODRUFYPBAKW-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl2O2 |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-2-methyl-4-propyl-1,3-dioxolane |
| InChIKey | ZOVODRUFYPBAKW-UHFFFAOYSA-N |
| SMILES | CCCC1COC(O1)(C)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)