Products 2470130-19-7
CAS 2470130-19-7 appears in our catalog under these names: DL-Indole-3-lactic Acid-d5, >95% (HPLC), Indolelactic acid–d5, Indolelactic acid-d5, 99.24%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2-hydroxy-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid (CAS 2470130-19-7) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 210.24 g/mol. IUPAC name: 2-hydroxy-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid. InChIKey: XGILAAMKEQUXLS-SNOLXCFTSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 210.24 g/mol |
| IUPAC name | 2-hydroxy-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
| InChIKey | XGILAAMKEQUXLS-SNOLXCFTSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])CC(C(=O)O)O)[2H])[2H] |
Computed by PubChem (NCBI)