CAS 24717-01-9 is the registry number for 2-Aminocyclohexanecarboxamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Cis-(1R,2S)-2-aminocyclohexane-1-carboxamide (CAS 24717-01-9) is a chemical compound with the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. IUPAC name: cis-(1R,2S)-2-aminocyclohexane-1-carboxamide. InChIKey: DXNKJRKPVQVDJW-RITPCOANSA-N.
| Molecular formula | C7H14N2O |
|---|---|
| Molecular weight | 142.20 g/mol |
| IUPAC name | cis-(1R,2S)-2-aminocyclohexane-1-carboxamide |
| InChIKey | DXNKJRKPVQVDJW-RITPCOANSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)N)N |
Computed by PubChem (NCBI)