CAS 26685-84-7 is the registry number for Rel-(1R,2R)-2-aminocyclohexane-1-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-2-aminocyclohexane-1-carboxamide (CAS 26685-84-7) is a chemical compound with the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. IUPAC name: trans-(1R,2R)-2-aminocyclohexane-1-carboxamide. InChIKey: DXNKJRKPVQVDJW-PHDIDXHHSA-N.
| Molecular formula | C7H14N2O |
|---|---|
| Molecular weight | 142.20 g/mol |
| IUPAC name | trans-(1R,2R)-2-aminocyclohexane-1-carboxamide |
| InChIKey | DXNKJRKPVQVDJW-PHDIDXHHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)C(=O)N)N |
Computed by PubChem (NCBI)