CAS 247186-96-5 is the registry number for ER-67880. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3-chloro-1H-indol-7-yl)-4-methoxybenzenesulfonamide (CAS 247186-96-5) is a chemical compound with the molecular formula C15H13ClN2O3S and a molecular weight of 336.8 g/mol. IUPAC name: N-(3-chloro-1H-indol-7-yl)-4-methoxybenzenesulfonamide. InChIKey: UEIFSFBNRBJSCK-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O3S |
|---|---|
| Molecular weight | 336.8 g/mol |
| IUPAC name | N-(3-chloro-1H-indol-7-yl)-4-methoxybenzenesulfonamide |
| InChIKey | UEIFSFBNRBJSCK-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC3=C2NC=C3Cl |
Computed by PubChem (NCBI)