CAS 380241-76-9 is the registry number for 1H–Indole–5–sulfonamide, N–(3–chlorophenyl)–2,3–dihydro–N–methyl–2–oxo–. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
N-(3-chlorophenyl)-N-methyl-2-oxo-1,3-dihydroindole-5-sulfonamide (CAS 380241-76-9) is a chemical compound with the molecular formula C15H13ClN2O3S and a molecular weight of 336.8 g/mol. IUPAC name: N-(3-chlorophenyl)-N-methyl-2-oxo-1,3-dihydroindole-5-sulfonamide. InChIKey: XCGIRHXZGVFBPI-UHFFFAOYSA-N.
| Molecular formula | C15H13ClN2O3S |
|---|---|
| Molecular weight | 336.8 g/mol |
| IUPAC name | N-(3-chlorophenyl)-N-methyl-2-oxo-1,3-dihydroindole-5-sulfonamide |
| InChIKey | XCGIRHXZGVFBPI-UHFFFAOYSA-N |
| SMILES | CN(C1=CC(=CC=C1)Cl)S(=O)(=O)C2=CC3=C(C=C2)NC(=O)C3 |
Computed by PubChem (NCBI)