Products 247186-99-8

CAS 247186-99-8 is the registry number for 4-(Methylsulfamoyl)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(methylsulfamoyl)benzenesulfonyl chloride (CAS 247186-99-8) is a chemical compound with the molecular formula C7H8ClNO4S2 and a molecular weight of 269.7 g/mol. IUPAC name: 4-(methylsulfamoyl)benzenesulfonyl chloride. InChIKey: BYFIYJHEXYSWEU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClNO4S2
Molecular weight269.7 g/mol
IUPAC name4-(methylsulfamoyl)benzenesulfonyl chloride
InChIKeyBYFIYJHEXYSWEU-UHFFFAOYSA-N
SMILESCNS(=O)(=O)C1=CC=C(C=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)